C8H9NO5 — CID 139300005
(1-hydroxy-2,5-dioxopyrrolidin-3-yl) 2-methylprop-2-enoate (PubChem CID 139300005) has the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. Its IUPAC name is (1-hydroxy-2,5-dioxopyrrolidin-3-yl) 2-methylprop-2-enoate.
| Compound Name | (1-hydroxy-2,5-dioxopyrrolidin-3-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139300005 |
| Molecular Formula | C8H9NO5 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | (1-hydroxy-2,5-dioxopyrrolidin-3-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC(=O)N(O)C1=O |
| InChI | InChI=1S/C8H9NO5/c1-4(2)8(12)14-5-3-6(10)9(13)7(5)11/h5,13H,1,3H2,2H3 |
| InChIKey | XLRZDZRJRDRGLU-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|