C19H17N3O4S — CID 23443429
4-[[4-[2-(1,3-benzoxazol-2-ylamino)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione (PubChem CID 23443429) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is 4-[[4-[2-(1,3-benzoxazol-2-ylamino)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[4-[2-(1,3-benzoxazol-2-ylamino)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 23443429 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 4-[[4-[2-(1,3-benzoxazol-2-ylamino)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione |
| SMILES | O=C1NC(Cc2ccc(OCCNc3nc4ccccc4o3)cc2)C(=O)S1 |
| InChI | InChI=1S/C19H17N3O4S/c23-17-15(22-19(24)27-17)11-12-5-7-13(8-6-12)25-10-9-20-18-21-14-3-1-2-4-16(14)26-18/h1-8,15H,9-11H2,(H,20,21)(H,22,24) |
| InChIKey | YGYRUFOLTKDYTN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|