C15H15N3O2 — CID 79893139
2-N-(2-phenoxyethyl)-1,3-benzoxazole-2,4-diamine (PubChem CID 79893139) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-N-(2-phenoxyethyl)-1,3-benzoxazole-2,4-diamine.
| Compound Name | 2-N-(2-phenoxyethyl)-1,3-benzoxazole-2,4-diamine |
|---|---|
| PubChem CID | 79893139 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-N-(2-phenoxyethyl)-1,3-benzoxazole-2,4-diamine |
| SMILES | Nc1cccc2oc(NCCOc3ccccc3)nc12 |
| InChI | InChI=1S/C15H15N3O2/c16-12-7-4-8-13-14(12)18-15(20-13)17-9-10-19-11-5-2-1-3-6-11/h1-8H,9-10,16H2,(H,17,18) |
| InChIKey | QXPKWLSSSIFPQI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|