C24H21NO4S — CID 158986644
5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methyl]thiolane-2,4-dione (PubChem CID 158986644) has the molecular formula C24H21NO4S and a molecular weight of 419.50 g/mol. Its IUPAC name is 5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methyl]thiolane-2,4-dione.
| Compound Name | 5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methyl]thiolane-2,4-dione |
|---|---|
| PubChem CID | 158986644 |
| Molecular Formula | C24H21NO4S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methyl]thiolane-2,4-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1CCC(=O)c1ccc(CC2SC(=O)CC2=O)cc1 |
| InChI | InChI=1S/C24H21NO4S/c1-15-19(25-24(29-15)18-5-3-2-4-6-18)11-12-20(26)17-9-7-16(8-10-17)13-22-21(27)14-23(28)30-22/h2-10,22H,11-14H2,1H3 |
| InChIKey | QEMGMQBKWKZCGR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|