C23H18N2O5 — CID 173326117
4-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methylidene]-1,3-oxazolidine-2,5-dione (PubChem CID 173326117) has the molecular formula C23H18N2O5 and a molecular weight of 402.41 g/mol. Its IUPAC name is 4-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methylidene]-1,3-oxazolidine-2,5-dione.
| Compound Name | 4-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methylidene]-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 173326117 |
| Molecular Formula | C23H18N2O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 4-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methylidene]-1,3-oxazolidine-2,5-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1CCC(=O)c1ccc(C=C2NC(=O)OC2=O)cc1 |
| InChI | InChI=1S/C23H18N2O5/c1-14-18(24-21(29-14)17-5-3-2-4-6-17)11-12-20(26)16-9-7-15(8-10-16)13-19-22(27)30-23(28)25-19/h2-10,13H,11-12H2,1H3,(H,25,28) |
| InChIKey | HXFPVFUMLWKNNY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|