C28H33NO5 — CID 142189302
tert-butyl 6-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-6-oxohexanoate (PubChem CID 142189302) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is tert-butyl 6-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-6-oxohexanoate.
| Compound Name | tert-butyl 6-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-6-oxohexanoate |
|---|---|
| PubChem CID | 142189302 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | tert-butyl 6-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-6-oxohexanoate |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc(C(=O)CCCCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C28H33NO5/c1-20-24(29-27(33-20)22-10-6-5-7-11-22)18-19-32-23-16-14-21(15-17-23)25(30)12-8-9-13-26(31)34-28(2,3)4/h5-7,10-11,14-17H,8-9,12-13,18-19H2,1-4H3 |
| InChIKey | CAAAIBNASRZEMZ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|