C22H18N2O5S — CID 54503212
5-[[4-[3-[5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazol-4-yl]propanoyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 54503212) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is 5-[[4-[3-[5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazol-4-yl]propanoyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[3-[5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazol-4-yl]propanoyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 54503212 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 5-[[4-[3-[5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazol-4-yl]propanoyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(-c2nc(CCC(=O)c3ccc(C=C4SC(=O)NC4=O)cc3)c(C)o2)o1 |
| InChI | InChI=1S/C22H18N2O5S/c1-12-3-10-18(28-12)21-23-16(13(2)29-21)8-9-17(25)15-6-4-14(5-7-15)11-19-20(26)24-22(27)30-19/h3-7,10-11H,8-9H2,1-2H3,(H,24,26,27) |
| InChIKey | YDWWGSAVCFQUMJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|