C20H16N2O6S — CID 59411536
(5E)-5-[[4-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 59411536) has the molecular formula C20H16N2O6S and a molecular weight of 412.42 g/mol. Its IUPAC name is (5E)-5-[[4-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 59411536 |
| Molecular Formula | C20H16N2O6S |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | (5E)-5-[[4-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/SC(=O)NC2=O)ccc1OCc1nc(-c2ccco2)oc1C |
| InChI | InChI=1S/C20H16N2O6S/c1-11-13(21-19(28-11)15-4-3-7-26-15)10-27-14-6-5-12(8-16(14)25-2)9-17-18(23)22-20(24)29-17/h3-9H,10H2,1-2H3,(H,22,23,24)/b17-9+ |
| InChIKey | BUCXBBGEUYGPAO-RQZCQDPDSA-N |
| XLogP | 4.15 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|