C24H27NO7 — CID 10863118
propan-2-yl 5-[4-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methoxyphenyl]-2-oxopentanoate (PubChem CID 10863118) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is propan-2-yl 5-[4-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methoxyphenyl]-2-oxopentanoate.
| Compound Name | propan-2-yl 5-[4-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methoxyphenyl]-2-oxopentanoate |
|---|---|
| PubChem CID | 10863118 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | propan-2-yl 5-[4-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methoxyphenyl]-2-oxopentanoate |
| SMILES | COc1cc(CCCC(=O)C(=O)OC(C)C)ccc1OCc1nc(-c2ccco2)oc1C |
| InChI | InChI=1S/C24H27NO7/c1-15(2)31-24(27)19(26)8-5-7-17-10-11-20(22(13-17)28-4)30-14-18-16(3)32-23(25-18)21-9-6-12-29-21/h6,9-13,15H,5,7-8,14H2,1-4H3 |
| InChIKey | HJMGLPSXDLBDIX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 101.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|