C21H16N2O4S2 — CID 177384837
(5E)-5-[[4-[3-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)propanoyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 177384837) has the molecular formula C21H16N2O4S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is (5E)-5-[[4-[3-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)propanoyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[3-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)propanoyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 177384837 |
| Molecular Formula | C21H16N2O4S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | (5E)-5-[[4-[3-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)propanoyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1oc(-c2cccs2)nc1CCC(=O)c1ccc(/C=C2/SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C21H16N2O4S2/c1-12-15(22-20(27-12)17-3-2-10-28-17)8-9-16(24)14-6-4-13(5-7-14)11-18-19(25)23-21(26)29-18/h2-7,10-11H,8-9H2,1H3,(H,23,25,26)/b18-11+ |
| InChIKey | VNWSGZJQSZQJFX-WOJGMQOQSA-N |
| XLogP | 4.85 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|