C23H16N2O5S — CID 88623049
5-[[2-(5-methyl-2-phenyl-1,3-oxazole-4-carbonyl)-1-benzofuran-5-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 88623049) has the molecular formula C23H16N2O5S and a molecular weight of 432.46 g/mol. Its IUPAC name is 5-[[2-(5-methyl-2-phenyl-1,3-oxazole-4-carbonyl)-1-benzofuran-5-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-(5-methyl-2-phenyl-1,3-oxazole-4-carbonyl)-1-benzofuran-5-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 88623049 |
| Molecular Formula | C23H16N2O5S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 5-[[2-(5-methyl-2-phenyl-1,3-oxazole-4-carbonyl)-1-benzofuran-5-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1C(=O)c1cc2cc(CC3SC(=O)NC3=O)ccc2o1 |
| InChI | InChI=1S/C23H16N2O5S/c1-12-19(24-22(29-12)14-5-3-2-4-6-14)20(26)17-11-15-9-13(7-8-16(15)30-17)10-18-21(27)25-23(28)31-18/h2-9,11,18H,10H2,1H3,(H,25,27,28) |
| InChIKey | CKEJYAOUAIORNJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|