C27H28N2O2 — CID 110253925
N-benzyl-N-methyl-3-[4-[(2-oxopiperidin-3-yl)methyl]phenyl]benzamide (PubChem CID 110253925) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-[4-[(2-oxopiperidin-3-yl)methyl]phenyl]benzamide.
| Compound Name | N-benzyl-N-methyl-3-[4-[(2-oxopiperidin-3-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 110253925 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | N-benzyl-N-methyl-3-[4-[(2-oxopiperidin-3-yl)methyl]phenyl]benzamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1cccc(-c2ccc(CC3CCCNC3=O)cc2)c1 |
| InChI | InChI=1S/C27H28N2O2/c1-29(19-21-7-3-2-4-8-21)27(31)25-10-5-9-23(18-25)22-14-12-20(13-15-22)17-24-11-6-16-28-26(24)30/h2-5,7-10,12-15,18,24H,6,11,16-17,19H2,1H3,(H,28,30) |
| InChIKey | RTLFKWVOSPUFOJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |