C23H25NO3 — CID 38011722
(2S)-N-[(4-methoxyphenyl)methyl]-N-methyl-2-naphthalen-2-yloxybutanamide (PubChem CID 38011722) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (2S)-N-[(4-methoxyphenyl)methyl]-N-methyl-2-naphthalen-2-yloxybutanamide.
| Compound Name | (2S)-N-[(4-methoxyphenyl)methyl]-N-methyl-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 38011722 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (2S)-N-[(4-methoxyphenyl)methyl]-N-methyl-2-naphthalen-2-yloxybutanamide |
| SMILES | CC[C@H](Oc1ccc2ccccc2c1)C(=O)N(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H25NO3/c1-4-22(27-21-14-11-18-7-5-6-8-19(18)15-21)23(25)24(2)16-17-9-12-20(26-3)13-10-17/h5-15,22H,4,16H2,1-3H3/t22-/m0/s1 |
| InChIKey | XHHDRLKUUVCTCS-QFIPXVFZSA-N |
| XLogP | 4.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |