C18H19Cl2NO2 — CID 94016620
(2S)-2-(3-chlorophenoxy)-N-[(4-chlorophenyl)methyl]-N-methylbutanamide (PubChem CID 94016620) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenoxy)-N-[(4-chlorophenyl)methyl]-N-methylbutanamide.
| Compound Name | (2S)-2-(3-chlorophenoxy)-N-[(4-chlorophenyl)methyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 94016620 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (2S)-2-(3-chlorophenoxy)-N-[(4-chlorophenyl)methyl]-N-methylbutanamide |
| SMILES | CC[C@H](Oc1cccc(Cl)c1)C(=O)N(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2NO2/c1-3-17(23-16-6-4-5-15(20)11-16)18(22)21(2)12-13-7-9-14(19)10-8-13/h4-11,17H,3,12H2,1-2H3/t17-/m0/s1 |
| InChIKey | CVDYVGZEHCISAQ-KRWDZBQOSA-N |
| XLogP | 4.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |