C22H22ClNO2 — CID 92646894
(2R)-N-[(4-chlorophenyl)methyl]-N-methyl-2-naphthalen-2-yloxybutanamide (PubChem CID 92646894) has the molecular formula C22H22ClNO2 and a molecular weight of 367.88 g/mol. Its IUPAC name is (2R)-N-[(4-chlorophenyl)methyl]-N-methyl-2-naphthalen-2-yloxybutanamide.
| Compound Name | (2R)-N-[(4-chlorophenyl)methyl]-N-methyl-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 92646894 |
| Molecular Formula | C22H22ClNO2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (2R)-N-[(4-chlorophenyl)methyl]-N-methyl-2-naphthalen-2-yloxybutanamide |
| SMILES | CC[C@@H](Oc1ccc2ccccc2c1)C(=O)N(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClNO2/c1-3-21(22(25)24(2)15-16-8-11-19(23)12-9-16)26-20-13-10-17-6-4-5-7-18(17)14-20/h4-14,21H,3,15H2,1-2H3/t21-/m1/s1 |
| InChIKey | RERPFPYLSSGKMP-OAQYLSRUSA-N |
| XLogP | 5.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |