C24H31N3O5 — CID 91406190
[3-[4-[3-(2-butanoylhydrazinyl)-2-ethoxy-3-oxopropyl]phenyl]phenyl]methyl-methylcarbamic acid (PubChem CID 91406190) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is [3-[4-[3-(2-butanoylhydrazinyl)-2-ethoxy-3-oxopropyl]phenyl]phenyl]methyl-methylcarbamic acid.
| Compound Name | [3-[4-[3-(2-butanoylhydrazinyl)-2-ethoxy-3-oxopropyl]phenyl]phenyl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 91406190 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | [3-[4-[3-(2-butanoylhydrazinyl)-2-ethoxy-3-oxopropyl]phenyl]phenyl]methyl-methylcarbamic acid |
| SMILES | CCCC(=O)NNC(=O)C(Cc1ccc(-c2cccc(CN(C)C(=O)O)c2)cc1)OCC |
| InChI | InChI=1S/C24H31N3O5/c1-4-7-22(28)25-26-23(29)21(32-5-2)15-17-10-12-19(13-11-17)20-9-6-8-18(14-20)16-27(3)24(30)31/h6,8-14,21H,4-5,7,15-16H2,1-3H3,(H,25,28)(H,26,29)(H,30,31) |
| InChIKey | DJGKGYNAKPDWNS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|