C27H37NO4 — CID 22341475
2-ethoxy-3-[4-[3-[(2-methyloctanoylamino)methyl]phenyl]phenyl]propanoic acid (PubChem CID 22341475) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[3-[(2-methyloctanoylamino)methyl]phenyl]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[3-[(2-methyloctanoylamino)methyl]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22341475 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 2-ethoxy-3-[4-[3-[(2-methyloctanoylamino)methyl]phenyl]phenyl]propanoic acid |
| SMILES | CCCCCCC(C)C(=O)NCc1cccc(-c2ccc(CC(OCC)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C27H37NO4/c1-4-6-7-8-10-20(3)26(29)28-19-22-11-9-12-24(17-22)23-15-13-21(14-16-23)18-25(27(30)31)32-5-2/h9,11-17,20,25H,4-8,10,18-19H2,1-3H3,(H,28,29)(H,30,31) |
| InChIKey | KDQHVZLYJVPKGO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|