C28H29NO5 — CID 68960034
(Z)-2-ethoxy-3-[4-[3-[[[2-(4-methoxyphenyl)-2-oxoethyl]amino]methyl]phenyl]-3-methylphenyl]prop-2-enoic acid (PubChem CID 68960034) has the molecular formula C28H29NO5 and a molecular weight of 459.54 g/mol. Its IUPAC name is (Z)-2-ethoxy-3-[4-[3-[[[2-(4-methoxyphenyl)-2-oxoethyl]amino]methyl]phenyl]-3-methylphenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-ethoxy-3-[4-[3-[[[2-(4-methoxyphenyl)-2-oxoethyl]amino]methyl]phenyl]-3-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68960034 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (Z)-2-ethoxy-3-[4-[3-[[[2-(4-methoxyphenyl)-2-oxoethyl]amino]methyl]phenyl]-3-methylphenyl]prop-2-enoic acid |
| SMILES | CCO/C(=C\c1ccc(-c2cccc(CNCC(=O)c3ccc(OC)cc3)c2)c(C)c1)C(=O)O |
| InChI | InChI=1S/C28H29NO5/c1-4-34-27(28(31)32)16-20-8-13-25(19(2)14-20)23-7-5-6-21(15-23)17-29-18-26(30)22-9-11-24(33-3)12-10-22/h5-16,29H,4,17-18H2,1-3H3,(H,31,32)/b27-16- |
| InChIKey | IJKBUKKPCDTXPP-YUMHPJSZSA-N |
| XLogP | 5.11 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|