C20H21FO5 — CID 71182860
(Z)-2-ethoxy-3-[4-[(2S)-2-fluoro-2-(3-methoxyphenyl)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 71182860) has the molecular formula C20H21FO5 and a molecular weight of 360.38 g/mol. Its IUPAC name is (Z)-2-ethoxy-3-[4-[(2S)-2-fluoro-2-(3-methoxyphenyl)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-ethoxy-3-[4-[(2S)-2-fluoro-2-(3-methoxyphenyl)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71182860 |
| Molecular Formula | C20H21FO5 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (Z)-2-ethoxy-3-[4-[(2S)-2-fluoro-2-(3-methoxyphenyl)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | CCO/C(=C\c1ccc(OC[C@@H](F)c2cccc(OC)c2)cc1)C(=O)O |
| InChI | InChI=1S/C20H21FO5/c1-3-25-19(20(22)23)11-14-7-9-16(10-8-14)26-13-18(21)15-5-4-6-17(12-15)24-2/h4-12,18H,3,13H2,1-2H3,(H,22,23)/b19-11-/t18-/m1/s1 |
| InChIKey | GNYPVBOCTIQRBO-NPBUNYCVSA-N |
| XLogP | 4.25 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|