C15H20O8 — CID 57052843
2-(2,3-dihydroxypropoxy)-3-[4-(2,3-dihydroxypropoxy)phenyl]prop-2-enoic acid (PubChem CID 57052843) has the molecular formula C15H20O8 and a molecular weight of 328.32 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropoxy)-3-[4-(2,3-dihydroxypropoxy)phenyl]prop-2-enoic acid.
| Compound Name | 2-(2,3-dihydroxypropoxy)-3-[4-(2,3-dihydroxypropoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 57052843 |
| Molecular Formula | C15H20O8 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-(2,3-dihydroxypropoxy)-3-[4-(2,3-dihydroxypropoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C(=Cc1ccc(OCC(O)CO)cc1)OCC(O)CO |
| InChI | InChI=1S/C15H20O8/c16-6-11(18)8-22-13-3-1-10(2-4-13)5-14(15(20)21)23-9-12(19)7-17/h1-5,11-12,16-19H,6-9H2,(H,20,21) |
| InChIKey | DUIOJFGDGHYFFU-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|