C48H49N3O4 — CID 91352781
naphthalen-2-ylmethyl 2-(2-benzoylanilino)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoate (PubChem CID 91352781) has the molecular formula C48H49N3O4 and a molecular weight of 731.94 g/mol. Its IUPAC name is naphthalen-2-ylmethyl 2-(2-benzoylanilino)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoate.
| Compound Name | naphthalen-2-ylmethyl 2-(2-benzoylanilino)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoate |
|---|---|
| PubChem CID | 91352781 |
| Molecular Formula | C48H49N3O4 |
| Molecular Weight | 731.94 g/mol |
| Exact Mass | 731.37 |
| IUPAC Name | naphthalen-2-ylmethyl 2-(2-benzoylanilino)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoate |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(CC(Nc3ccccc3C(=O)c3ccccc3)C(=O)OCc3ccc4ccccc4c3)cc2)c1 |
| InChI | InChI=1S/C48H49N3O4/c1-3-4-5-6-14-30-49-48(54)51(2)42-21-15-20-41(33-42)38-27-24-35(25-28-38)32-45(47(53)55-34-36-26-29-37-16-10-11-19-40(37)31-36)50-44-23-13-12-22-43(44)46(52)39-17-8-7-9-18-39/h7-13,15-29,31,33,45,50H,3-6,14,30,32,34H2,1-2H3,(H,49,54) |
| InChIKey | GGXSQGDBYWNKTK-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.94 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|