C41H48N4O4 — CID 10462027
1-[3-[4-[(2S)-2-(2-benzoylanilino)-3-morpholin-4-yl-3-oxopropyl]phenyl]phenyl]-3-heptyl-1-methylurea (PubChem CID 10462027) has the molecular formula C41H48N4O4 and a molecular weight of 660.86 g/mol. Its IUPAC name is 1-[3-[4-[(2S)-2-(2-benzoylanilino)-3-morpholin-4-yl-3-oxopropyl]phenyl]phenyl]-3-heptyl-1-methylurea.
| Compound Name | 1-[3-[4-[(2S)-2-(2-benzoylanilino)-3-morpholin-4-yl-3-oxopropyl]phenyl]phenyl]-3-heptyl-1-methylurea |
|---|---|
| PubChem CID | 10462027 |
| Molecular Formula | C41H48N4O4 |
| Molecular Weight | 660.86 g/mol |
| Exact Mass | 660.37 |
| IUPAC Name | 1-[3-[4-[(2S)-2-(2-benzoylanilino)-3-morpholin-4-yl-3-oxopropyl]phenyl]phenyl]-3-heptyl-1-methylurea |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(C[C@H](Nc3ccccc3C(=O)c3ccccc3)C(=O)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C41H48N4O4/c1-3-4-5-6-12-24-42-41(48)44(2)35-17-13-16-34(30-35)32-22-20-31(21-23-32)29-38(40(47)45-25-27-49-28-26-45)43-37-19-11-10-18-36(37)39(46)33-14-8-7-9-15-33/h7-11,13-23,30,38,43H,3-6,12,24-29H2,1-2H3,(H,42,48)/t38-/m0/s1 |
| InChIKey | LRGLNPDSQYEJFV-LHEWISCISA-N |
| XLogP | 7.58 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.86 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|