C49H52N4O5 — CID 90731577
ethyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoate (PubChem CID 90731577) has the molecular formula C49H52N4O5 and a molecular weight of 776.98 g/mol. Its IUPAC name is ethyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoate.
| Compound Name | ethyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoate |
|---|---|
| PubChem CID | 90731577 |
| Molecular Formula | C49H52N4O5 |
| Molecular Weight | 776.98 g/mol |
| Exact Mass | 776.39 |
| IUPAC Name | ethyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoate |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(C[C@@](Nc3ccccc3C(=O)c3ccccc3)(C(=O)OCC)c3nc(-c4ccccc4)oc3C)cc2)c1 |
| InChI | InChI=1S/C49H52N4O5/c1-5-7-8-9-18-32-50-48(56)53(4)41-25-19-24-40(33-41)37-30-28-36(29-31-37)34-49(47(55)57-6-2,45-35(3)58-46(51-45)39-22-14-11-15-23-39)52-43-27-17-16-26-42(43)44(54)38-20-12-10-13-21-38/h10-17,19-31,33,52H,5-9,18,32,34H2,1-4H3,(H,50,56)/t49-/m0/s1 |
| InChIKey | XNTADBODURFKGY-GGCSAXROSA-N |
| XLogP | 10.78 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.98 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|