C35H38N2O4S — CID 67147917
methyl 2-(2-benzoylanilino)-3-[4-[5-[[hexanoyl(methyl)amino]methyl]thiophen-3-yl]phenyl]propanoate (PubChem CID 67147917) has the molecular formula C35H38N2O4S and a molecular weight of 582.77 g/mol. Its IUPAC name is methyl 2-(2-benzoylanilino)-3-[4-[5-[[hexanoyl(methyl)amino]methyl]thiophen-3-yl]phenyl]propanoate.
| Compound Name | methyl 2-(2-benzoylanilino)-3-[4-[5-[[hexanoyl(methyl)amino]methyl]thiophen-3-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 67147917 |
| Molecular Formula | C35H38N2O4S |
| Molecular Weight | 582.77 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | methyl 2-(2-benzoylanilino)-3-[4-[5-[[hexanoyl(methyl)amino]methyl]thiophen-3-yl]phenyl]propanoate |
| SMILES | CCCCCC(=O)N(C)Cc1cc(-c2ccc(CC(Nc3ccccc3C(=O)c3ccccc3)C(=O)OC)cc2)cs1 |
| InChI | InChI=1S/C35H38N2O4S/c1-4-5-7-16-33(38)37(2)23-29-22-28(24-42-29)26-19-17-25(18-20-26)21-32(35(40)41-3)36-31-15-11-10-14-30(31)34(39)27-12-8-6-9-13-27/h6,8-15,17-20,22,24,32,36H,4-5,7,16,21,23H2,1-3H3 |
| InChIKey | IKUOIYXQGAHLGS-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.77 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|