C27H36N2O3 — CID 77257643
ethyl 3-[4-[5-[heptylcarbamoyl(methyl)amino]-2-methylphenyl]phenyl]prop-2-enoate (PubChem CID 77257643) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is ethyl 3-[4-[5-[heptylcarbamoyl(methyl)amino]-2-methylphenyl]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[5-[heptylcarbamoyl(methyl)amino]-2-methylphenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 77257643 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | ethyl 3-[4-[5-[heptylcarbamoyl(methyl)amino]-2-methylphenyl]phenyl]prop-2-enoate |
| SMILES | CCCCCCCNC(=O)N(C)c1ccc(C)c(-c2ccc(C=CC(=O)OCC)cc2)c1 |
| InChI | InChI=1S/C27H36N2O3/c1-5-7-8-9-10-19-28-27(31)29(4)24-17-11-21(3)25(20-24)23-15-12-22(13-16-23)14-18-26(30)32-6-2/h11-18,20H,5-10,19H2,1-4H3,(H,28,31) |
| InChIKey | UVRKBXSVLMBIHT-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|