C23H32N4O3 — CID 77188279
2-(ethylamino)-3-[4-[6-[methyl(pentylcarbamoyl)amino]-2-pyridinyl]phenyl]propanoic acid (PubChem CID 77188279) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-(ethylamino)-3-[4-[6-[methyl(pentylcarbamoyl)amino]-2-pyridinyl]phenyl]propanoic acid.
| Compound Name | 2-(ethylamino)-3-[4-[6-[methyl(pentylcarbamoyl)amino]-2-pyridinyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 77188279 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 2-(ethylamino)-3-[4-[6-[methyl(pentylcarbamoyl)amino]-2-pyridinyl]phenyl]propanoic acid |
| SMILES | CCCCCNC(=O)N(C)c1cccc(-c2ccc(CC(NCC)C(=O)O)cc2)n1 |
| InChI | InChI=1S/C23H32N4O3/c1-4-6-7-15-25-23(30)27(3)21-10-8-9-19(26-21)18-13-11-17(12-14-18)16-20(22(28)29)24-5-2/h8-14,20,24H,4-7,15-16H2,1-3H3,(H,25,30)(H,28,29) |
| InChIKey | PYAJJFASBODLFR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|