C25H34N2O5 — CID 58582506
(2S)-3-[4-[3-[butylcarbamoyl(methyl)amino]propoxy]phenyl]-2-methyl-2-phenoxypropanoic acid (PubChem CID 58582506) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is (2S)-3-[4-[3-[butylcarbamoyl(methyl)amino]propoxy]phenyl]-2-methyl-2-phenoxypropanoic acid.
| Compound Name | (2S)-3-[4-[3-[butylcarbamoyl(methyl)amino]propoxy]phenyl]-2-methyl-2-phenoxypropanoic acid |
|---|---|
| PubChem CID | 58582506 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | (2S)-3-[4-[3-[butylcarbamoyl(methyl)amino]propoxy]phenyl]-2-methyl-2-phenoxypropanoic acid |
| SMILES | CCCCNC(=O)N(C)CCCOc1ccc(C[C@](C)(Oc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C25H34N2O5/c1-4-5-16-26-24(30)27(3)17-9-18-31-21-14-12-20(13-15-21)19-25(2,23(28)29)32-22-10-7-6-8-11-22/h6-8,10-15H,4-5,9,16-19H2,1-3H3,(H,26,30)(H,28,29)/t25-/m0/s1 |
| InChIKey | OFIRXHDRYRIEGJ-VWLOTQADSA-N |
| XLogP | 4.36 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|