C23H31NOS — CID 141146367
N-methyl-N-[[3-(5-prop-2-enylthiophen-2-yl)phenyl]methyl]octanamide (PubChem CID 141146367) has the molecular formula C23H31NOS and a molecular weight of 369.57 g/mol. Its IUPAC name is N-methyl-N-[[3-(5-prop-2-enylthiophen-2-yl)phenyl]methyl]octanamide.
| Compound Name | N-methyl-N-[[3-(5-prop-2-enylthiophen-2-yl)phenyl]methyl]octanamide |
|---|---|
| PubChem CID | 141146367 |
| Molecular Formula | C23H31NOS |
| Molecular Weight | 369.57 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-methyl-N-[[3-(5-prop-2-enylthiophen-2-yl)phenyl]methyl]octanamide |
| SMILES | C=CCc1ccc(-c2cccc(CN(C)C(=O)CCCCCCC)c2)s1 |
| InChI | InChI=1S/C23H31NOS/c1-4-6-7-8-9-14-23(25)24(3)18-19-12-10-13-20(17-19)22-16-15-21(26-22)11-5-2/h5,10,12-13,15-17H,2,4,6-9,11,14,18H2,1,3H3 |
| InChIKey | UWEAAVDBPJRMKS-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.57 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|