C23H32N2O3S — CID 67321508
(2S)-2-(ethylamino)-3-[4-[5-[(2-oxoheptylamino)methyl]thiophen-3-yl]phenyl]propanoic acid (PubChem CID 67321508) has the molecular formula C23H32N2O3S and a molecular weight of 416.59 g/mol. Its IUPAC name is (2S)-2-(ethylamino)-3-[4-[5-[(2-oxoheptylamino)methyl]thiophen-3-yl]phenyl]propanoic acid.
| Compound Name | (2S)-2-(ethylamino)-3-[4-[5-[(2-oxoheptylamino)methyl]thiophen-3-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67321508 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (2S)-2-(ethylamino)-3-[4-[5-[(2-oxoheptylamino)methyl]thiophen-3-yl]phenyl]propanoic acid |
| SMILES | CCCCCC(=O)CNCc1cc(-c2ccc(C[C@H](NCC)C(=O)O)cc2)cs1 |
| InChI | InChI=1S/C23H32N2O3S/c1-3-5-6-7-20(26)14-24-15-21-13-19(16-29-21)18-10-8-17(9-11-18)12-22(23(27)28)25-4-2/h8-11,13,16,22,24-25H,3-7,12,14-15H2,1-2H3,(H,27,28)/t22-/m0/s1 |
| InChIKey | NJKCQYRJBPRMCE-QFIPXVFZSA-N |
| XLogP | 4.26 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|