C15H26N2O4 — CID 174361704
3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid;N-pentylhydroxylamine (PubChem CID 174361704) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid;N-pentylhydroxylamine.
| Compound Name | 3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid;N-pentylhydroxylamine |
|---|---|
| PubChem CID | 174361704 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid;N-pentylhydroxylamine |
| SMILES | CCCCCNO.CNC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C10H13NO3.C5H13NO/c1-11-9(10(13)14)6-7-2-4-8(12)5-3-7;1-2-3-4-5-6-7/h2-5,9,11-12H,6H2,1H3,(H,13,14);6-7H,2-5H2,1H3 |
| InChIKey | LVNAAXDTUOCZKD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|