C18H29NO3 — CID 70400209
octan-2-yl (2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoate (PubChem CID 70400209) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is octan-2-yl (2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoate.
| Compound Name | octan-2-yl (2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 70400209 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | octan-2-yl (2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoate |
| SMILES | CCCCCCC(C)OC(=O)[C@H](Cc1ccc(O)cc1)NC |
| InChI | InChI=1S/C18H29NO3/c1-4-5-6-7-8-14(2)22-18(21)17(19-3)13-15-9-11-16(20)12-10-15/h9-12,14,17,19-20H,4-8,13H2,1-3H3/t14?,17-/m0/s1 |
| InChIKey | ZMLPEAQVDUXXHG-JRZJBTRGSA-N |
| XLogP | 3.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|