C15H24N2O3 — CID 141493620
hexyl (2S)-2-hydrazinyl-3-(4-hydroxyphenyl)propanoate (PubChem CID 141493620) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is hexyl (2S)-2-hydrazinyl-3-(4-hydroxyphenyl)propanoate.
| Compound Name | hexyl (2S)-2-hydrazinyl-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 141493620 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | hexyl (2S)-2-hydrazinyl-3-(4-hydroxyphenyl)propanoate |
| SMILES | CCCCCCOC(=O)[C@H](Cc1ccc(O)cc1)NN |
| InChI | InChI=1S/C15H24N2O3/c1-2-3-4-5-10-20-15(19)14(17-16)11-12-6-8-13(18)9-7-12/h6-9,14,17-18H,2-5,10-11,16H2,1H3/t14-/m0/s1 |
| InChIKey | YTXQAYDOOKXDDV-AWEZNQCLSA-N |
| XLogP | 1.89 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|