C40H33N3O4 — CID 68643333
2-(2-benzoylanilino)-3-[4-[3-[(1-methylnaphthalen-2-yl)carbamoylamino]phenyl]phenyl]propanoic acid (PubChem CID 68643333) has the molecular formula C40H33N3O4 and a molecular weight of 619.72 g/mol. Its IUPAC name is 2-(2-benzoylanilino)-3-[4-[3-[(1-methylnaphthalen-2-yl)carbamoylamino]phenyl]phenyl]propanoic acid.
| Compound Name | 2-(2-benzoylanilino)-3-[4-[3-[(1-methylnaphthalen-2-yl)carbamoylamino]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 68643333 |
| Molecular Formula | C40H33N3O4 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.25 |
| IUPAC Name | 2-(2-benzoylanilino)-3-[4-[3-[(1-methylnaphthalen-2-yl)carbamoylamino]phenyl]phenyl]propanoic acid |
| SMILES | Cc1c(NC(=O)Nc2cccc(-c3ccc(CC(Nc4ccccc4C(=O)c4ccccc4)C(=O)O)cc3)c2)ccc2ccccc12 |
| InChI | InChI=1S/C40H33N3O4/c1-26-33-15-6-5-10-29(33)22-23-35(26)43-40(47)41-32-14-9-13-31(25-32)28-20-18-27(19-21-28)24-37(39(45)46)42-36-17-8-7-16-34(36)38(44)30-11-3-2-4-12-30/h2-23,25,37,42H,24H2,1H3,(H,45,46)(H2,41,43,47) |
| InChIKey | IWAIGUXWGMMGGN-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|