C24H21N3O7 — CID 68961347
(Z)-2-ethoxy-3-[6-[3-[methyl-(4-nitrophenoxy)carbonylamino]phenyl]-3-pyridinyl]prop-2-enoic acid (PubChem CID 68961347) has the molecular formula C24H21N3O7 and a molecular weight of 463.45 g/mol. Its IUPAC name is (Z)-2-ethoxy-3-[6-[3-[methyl-(4-nitrophenoxy)carbonylamino]phenyl]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (Z)-2-ethoxy-3-[6-[3-[methyl-(4-nitrophenoxy)carbonylamino]phenyl]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68961347 |
| Molecular Formula | C24H21N3O7 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | (Z)-2-ethoxy-3-[6-[3-[methyl-(4-nitrophenoxy)carbonylamino]phenyl]-3-pyridinyl]prop-2-enoic acid |
| SMILES | CCO/C(=C\c1ccc(-c2cccc(N(C)C(=O)Oc3ccc([N+](=O)[O-])cc3)c2)nc1)C(=O)O |
| InChI | InChI=1S/C24H21N3O7/c1-3-33-22(23(28)29)13-16-7-12-21(25-15-16)17-5-4-6-19(14-17)26(2)24(30)34-20-10-8-18(9-11-20)27(31)32/h4-15H,3H2,1-2H3,(H,28,29)/b22-13- |
| InChIKey | PBYLMBCTCFVMEF-XKZIYDEJSA-N |
| XLogP | 4.75 |
| TPSA | 132.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|