C25H22N2O6 — CID 68956460
(2Z)-2-[[4-[3-[methyl-(4-nitrophenoxy)carbonylamino]phenyl]phenyl]methylidene]butanoic acid (PubChem CID 68956460) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is (2Z)-2-[[4-[3-[methyl-(4-nitrophenoxy)carbonylamino]phenyl]phenyl]methylidene]butanoic acid.
| Compound Name | (2Z)-2-[[4-[3-[methyl-(4-nitrophenoxy)carbonylamino]phenyl]phenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 68956460 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (2Z)-2-[[4-[3-[methyl-(4-nitrophenoxy)carbonylamino]phenyl]phenyl]methylidene]butanoic acid |
| SMILES | CC/C(=C/c1ccc(-c2cccc(N(C)C(=O)Oc3ccc([N+](=O)[O-])cc3)c2)cc1)C(=O)O |
| InChI | InChI=1S/C25H22N2O6/c1-3-18(24(28)29)15-17-7-9-19(10-8-17)20-5-4-6-22(16-20)26(2)25(30)33-23-13-11-21(12-14-23)27(31)32/h4-16H,3H2,1-2H3,(H,28,29)/b18-15- |
| InChIKey | RNWVPCQHXOYTIX-SDXDJHTJSA-N |
| XLogP | 5.78 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|