C26H29N3O2 — CID 11464160
3,3-dimethyl-N-[1-[(6-phenoxy-3-pyridinyl)methyl]-2,3-dihydroindol-5-yl]butanamide (PubChem CID 11464160) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3,3-dimethyl-N-[1-[(6-phenoxy-3-pyridinyl)methyl]-2,3-dihydroindol-5-yl]butanamide.
| Compound Name | 3,3-dimethyl-N-[1-[(6-phenoxy-3-pyridinyl)methyl]-2,3-dihydroindol-5-yl]butanamide |
|---|---|
| PubChem CID | 11464160 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3,3-dimethyl-N-[1-[(6-phenoxy-3-pyridinyl)methyl]-2,3-dihydroindol-5-yl]butanamide |
| SMILES | CC(C)(C)CC(=O)Nc1ccc2c(c1)CCN2Cc1ccc(Oc2ccccc2)nc1 |
| InChI | InChI=1S/C26H29N3O2/c1-26(2,3)16-24(30)28-21-10-11-23-20(15-21)13-14-29(23)18-19-9-12-25(27-17-19)31-22-7-5-4-6-8-22/h4-12,15,17H,13-14,16,18H2,1-3H3,(H,28,30) |
| InChIKey | VRZBOVWQXQFOCD-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|