C15H22N2O — CID 110729245
3,3-dimethyl-N-(1-methyl-2,3-dihydroindol-6-yl)butanamide (PubChem CID 110729245) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 3,3-dimethyl-N-(1-methyl-2,3-dihydroindol-6-yl)butanamide.
| Compound Name | 3,3-dimethyl-N-(1-methyl-2,3-dihydroindol-6-yl)butanamide |
|---|---|
| PubChem CID | 110729245 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 3,3-dimethyl-N-(1-methyl-2,3-dihydroindol-6-yl)butanamide |
| SMILES | CN1CCc2ccc(NC(=O)CC(C)(C)C)cc21 |
| InChI | InChI=1S/C15H22N2O/c1-15(2,3)10-14(18)16-12-6-5-11-7-8-17(4)13(11)9-12/h5-6,9H,7-8,10H2,1-4H3,(H,16,18) |
| InChIKey | IEUZGIIFBSOIBO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |