C11H11F3N2O — CID 153408429
2,2,2-trifluoro-N-(1-methyl-2,3-dihydroindol-6-yl)acetamide (PubChem CID 153408429) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(1-methyl-2,3-dihydroindol-6-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(1-methyl-2,3-dihydroindol-6-yl)acetamide |
|---|---|
| PubChem CID | 153408429 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2,2,2-trifluoro-N-(1-methyl-2,3-dihydroindol-6-yl)acetamide |
| SMILES | CN1CCc2ccc(NC(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C11H11F3N2O/c1-16-5-4-7-2-3-8(6-9(7)16)15-10(17)11(12,13)14/h2-3,6H,4-5H2,1H3,(H,15,17) |
| InChIKey | ZIGFASWICDJMBQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |