C13H15ClF3N3O — CID 17334956
N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 17334956) has the molecular formula C13H15ClF3N3O and a molecular weight of 321.73 g/mol. Its IUPAC name is N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 17334956 |
| Molecular Formula | C13H15ClF3N3O |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | CN1CCN(c2ccc(NC(=O)C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C13H15ClF3N3O/c1-19-4-6-20(7-5-19)11-3-2-9(8-10(11)14)18-12(21)13(15,16)17/h2-3,8H,4-7H2,1H3,(H,18,21) |
| InChIKey | AAZWQIVHPPEYSW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|