C16H19F3N2O — CID 142743429
N-(1-cyclohexyl-2,3-dihydroindol-6-yl)-2,2,2-trifluoroacetamide (PubChem CID 142743429) has the molecular formula C16H19F3N2O and a molecular weight of 312.33 g/mol. Its IUPAC name is N-(1-cyclohexyl-2,3-dihydroindol-6-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(1-cyclohexyl-2,3-dihydroindol-6-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 142743429 |
| Molecular Formula | C16H19F3N2O |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-(1-cyclohexyl-2,3-dihydroindol-6-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ccc2c(c1)N(C1CCCCC1)CC2)C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O/c17-16(18,19)15(22)20-12-7-6-11-8-9-21(14(11)10-12)13-4-2-1-3-5-13/h6-7,10,13H,1-5,8-9H2,(H,20,22) |
| InChIKey | AXRWEVCXJXDBNV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |