C13H18N4O2 — CID 175745823
2-[(1-methyl-2,3-dihydroindol-6-yl)carbamoylamino]propanamide (PubChem CID 175745823) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[(1-methyl-2,3-dihydroindol-6-yl)carbamoylamino]propanamide.
| Compound Name | 2-[(1-methyl-2,3-dihydroindol-6-yl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 175745823 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-[(1-methyl-2,3-dihydroindol-6-yl)carbamoylamino]propanamide |
| SMILES | CC(NC(=O)Nc1ccc2c(c1)N(C)CC2)C(N)=O |
| InChI | InChI=1S/C13H18N4O2/c1-8(12(14)18)15-13(19)16-10-4-3-9-5-6-17(2)11(9)7-10/h3-4,7-8H,5-6H2,1-2H3,(H2,14,18)(H2,15,16,19) |
| InChIKey | FZZJSRWMRHLENG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |