C15H23N3O3S — CID 46386113
1-butan-2-yl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea (PubChem CID 46386113) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 1-butan-2-yl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea.
| Compound Name | 1-butan-2-yl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea |
|---|---|
| PubChem CID | 46386113 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-butan-2-yl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea |
| SMILES | CCC(C)NC(=O)Nc1ccc2c(c1)N(S(=O)(=O)CC)CC2 |
| InChI | InChI=1S/C15H23N3O3S/c1-4-11(3)16-15(19)17-13-7-6-12-8-9-18(14(12)10-13)22(20,21)5-2/h6-7,10-11H,4-5,8-9H2,1-3H3,(H2,16,17,19) |
| InChIKey | MKNBWQPWINJURD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |