C17H27N3O3S — CID 110623674
1-(1-butylsulfonyl-2,3-dihydroindol-6-yl)-3-(2-methylpropyl)urea (PubChem CID 110623674) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is 1-(1-butylsulfonyl-2,3-dihydroindol-6-yl)-3-(2-methylpropyl)urea.
| Compound Name | 1-(1-butylsulfonyl-2,3-dihydroindol-6-yl)-3-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 110623674 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 1-(1-butylsulfonyl-2,3-dihydroindol-6-yl)-3-(2-methylpropyl)urea |
| SMILES | CCCCS(=O)(=O)N1CCc2ccc(NC(=O)NCC(C)C)cc21 |
| InChI | InChI=1S/C17H27N3O3S/c1-4-5-10-24(22,23)20-9-8-14-6-7-15(11-16(14)20)19-17(21)18-12-13(2)3/h6-7,11,13H,4-5,8-10,12H2,1-3H3,(H2,18,19,21) |
| InChIKey | DVRQTRXJOBQTLV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |