C17H26N2O3S — CID 71918240
N-(1-butyl-2,3-dihydroindol-6-yl)-2-propylsulfonylacetamide (PubChem CID 71918240) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is N-(1-butyl-2,3-dihydroindol-6-yl)-2-propylsulfonylacetamide.
| Compound Name | N-(1-butyl-2,3-dihydroindol-6-yl)-2-propylsulfonylacetamide |
|---|---|
| PubChem CID | 71918240 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-(1-butyl-2,3-dihydroindol-6-yl)-2-propylsulfonylacetamide |
| SMILES | CCCCN1CCc2ccc(NC(=O)CS(=O)(=O)CCC)cc21 |
| InChI | InChI=1S/C17H26N2O3S/c1-3-5-9-19-10-8-14-6-7-15(12-16(14)19)18-17(20)13-23(21,22)11-4-2/h6-7,12H,3-5,8-11,13H2,1-2H3,(H,18,20) |
| InChIKey | WDDVJTMGFMZKKK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |