C19H27N3O2 — CID 71917851
1-(1-butyl-2,3-dihydroindol-6-yl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea (PubChem CID 71917851) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-(1-butyl-2,3-dihydroindol-6-yl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea.
| Compound Name | 1-(1-butyl-2,3-dihydroindol-6-yl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
|---|---|
| PubChem CID | 71917851 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 1-(1-butyl-2,3-dihydroindol-6-yl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
| SMILES | CCCCN1CCc2ccc(NC(=O)N[C@@H]3C=C[C@H](CO)C3)cc21 |
| InChI | InChI=1S/C19H27N3O2/c1-2-3-9-22-10-8-15-5-7-17(12-18(15)22)21-19(24)20-16-6-4-14(11-16)13-23/h4-7,12,14,16,23H,2-3,8-11,13H2,1H3,(H2,20,21,24)/t14-,16+/m0/s1 |
| InChIKey | QJKAHQMLQJPJEH-GOEBONIOSA-N |
| XLogP | 2.91 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|