C14H17BrN2O3 — CID 111637055
1-(4-bromo-3-methoxyphenyl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea (PubChem CID 111637055) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.21 g/mol. Its IUPAC name is 1-(4-bromo-3-methoxyphenyl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea.
| Compound Name | 1-(4-bromo-3-methoxyphenyl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
|---|---|
| PubChem CID | 111637055 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 1-(4-bromo-3-methoxyphenyl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
| SMILES | COc1cc(NC(=O)N[C@@H]2C=C[C@H](CO)C2)ccc1Br |
| InChI | InChI=1S/C14H17BrN2O3/c1-20-13-7-11(4-5-12(13)15)17-14(19)16-10-3-2-9(6-10)8-18/h2-5,7,9-10,18H,6,8H2,1H3,(H2,16,17,19)/t9-,10+/m0/s1 |
| InChIKey | NQOQQKWABRBGAV-VHSXEESVSA-N |
| XLogP | 2.52 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|