About 1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea
1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea (PubChem CID 46386241) has the molecular formula C14H21N3O3S
and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea.
Molecular Properties
| Compound Name | 1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea |
| PubChem CID | 46386241 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea |
| SMILES | CC(C)CNC(=O)Nc1ccc2c(c1)N(S(C)(=O)=O)CC2 |
| InChI | InChI=1S/C14H21N3O3S/c1-10(2)9-15-14(18)16-12-5-4-11-6-7-17(13(11)8-12)21(3,19)20/h4-5,8,10H,6-7,9H2,1-3H3,(H2,15,16,18) |
| InChIKey | RXVCAJHMHUKMIF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea?
The IUPAC name of 1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea (CID 46386241) is 1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea.
What is the SMILES notation for 1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea?
The canonical SMILES for 1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea is CC(C)CNC(=O)Nc1ccc2c(c1)N(S(C)(=O)=O)CC2.
What is the InChIKey of 1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea?
The InChIKey is RXVCAJHMHUKMIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3S/c1-10(2)9-15-14(18)16-12-5-4-11-6-7-17(13(11)8-12)21(3,19)20/h4-5,8,10H,6-7,9H2,1-3H3,(H2,15,16,18).
What are the key properties of 1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea?
1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea has a molecular weight of 311.41 g/mol, XLogP of 1.79, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylpropyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea is sourced from PubChem (CID 46386241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).