C16H15ClFN3O3S — CID 46386232
1-(4-chloro-2-fluorophenyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea (PubChem CID 46386232) has the molecular formula C16H15ClFN3O3S and a molecular weight of 383.83 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea |
|---|---|
| PubChem CID | 46386232 |
| Molecular Formula | C16H15ClFN3O3S |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3-(1-methylsulfonyl-2,3-dihydroindol-6-yl)urea |
| SMILES | CS(=O)(=O)N1CCc2ccc(NC(=O)Nc3ccc(Cl)cc3F)cc21 |
| InChI | InChI=1S/C16H15ClFN3O3S/c1-25(23,24)21-7-6-10-2-4-12(9-15(10)21)19-16(22)20-14-5-3-11(17)8-13(14)18/h2-5,8-9H,6-7H2,1H3,(H2,19,20,22) |
| InChIKey | OSPVHRXFNABIOZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |