C17H19N3O3S2 — CID 46389806
1-(3-methylsulfanylphenyl)-3-(1-methylsulfonyl-2,3-dihydroindol-5-yl)urea (PubChem CID 46389806) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-(3-methylsulfanylphenyl)-3-(1-methylsulfonyl-2,3-dihydroindol-5-yl)urea.
| Compound Name | 1-(3-methylsulfanylphenyl)-3-(1-methylsulfonyl-2,3-dihydroindol-5-yl)urea |
|---|---|
| PubChem CID | 46389806 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1-(3-methylsulfanylphenyl)-3-(1-methylsulfonyl-2,3-dihydroindol-5-yl)urea |
| SMILES | CSc1cccc(NC(=O)Nc2ccc3c(c2)CCN3S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H19N3O3S2/c1-24-15-5-3-4-13(11-15)18-17(21)19-14-6-7-16-12(10-14)8-9-20(16)25(2,22)23/h3-7,10-11H,8-9H2,1-2H3,(H2,18,19,21) |
| InChIKey | ASBMZKGZRBNGJX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |