C18H21N3O3S2 — CID 46386100
1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-(3-methylsulfanylphenyl)urea (PubChem CID 46386100) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 46386100 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-(3-methylsulfanylphenyl)urea |
| SMILES | CCS(=O)(=O)N1CCc2ccc(NC(=O)Nc3cccc(SC)c3)cc21 |
| InChI | InChI=1S/C18H21N3O3S2/c1-3-26(23,24)21-10-9-13-7-8-15(12-17(13)21)20-18(22)19-14-5-4-6-16(11-14)25-2/h4-8,11-12H,3,9-10H2,1-2H3,(H2,19,20,22) |
| InChIKey | YDJXTUIFGGTHDT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |